About 6-oxo-N-pentylhexanamide
6-oxo-N-pentylhexanamide (PubChem CID 90124095) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 6-oxo-N-pentylhexanamide.
Molecular Properties
| Compound Name | 6-oxo-N-pentylhexanamide |
| PubChem CID | 90124095 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 6-oxo-N-pentylhexanamide |
| SMILES | CCCCCNC(=O)CCCCC=O |
| InChI | InChI=1S/C11H21NO2/c1-2-3-6-9-12-11(14)8-5-4-7-10-13/h10H,2-9H2,1H3,(H,12,14) |
| InChIKey | IGHZPPAUZJXWLC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-N-pentylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N-pentylhexanamide?
The IUPAC name of 6-oxo-N-pentylhexanamide (CID 90124095) is 6-oxo-N-pentylhexanamide.
What is the SMILES notation for 6-oxo-N-pentylhexanamide?
The canonical SMILES for 6-oxo-N-pentylhexanamide is CCCCCNC(=O)CCCCC=O.
What is the InChIKey of 6-oxo-N-pentylhexanamide?
The InChIKey is IGHZPPAUZJXWLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-2-3-6-9-12-11(14)8-5-4-7-10-13/h10H,2-9H2,1H3,(H,12,14).
What are the key properties of 6-oxo-N-pentylhexanamide?
6-oxo-N-pentylhexanamide has a molecular weight of 199.29 g/mol, XLogP of 2.05, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N-pentylhexanamide is sourced from PubChem (CID 90124095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).