About N-methylethanamine;5-oxopentanamide
N-methylethanamine;5-oxopentanamide (PubChem CID 143785346) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is N-methylethanamine;5-oxopentanamide.
Molecular Properties
| Compound Name | N-methylethanamine;5-oxopentanamide |
| PubChem CID | 143785346 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | N-methylethanamine;5-oxopentanamide |
| SMILES | CCNC.NC(=O)CCCC=O |
| InChI | InChI=1S/C5H9NO2.C3H9N/c6-5(8)3-1-2-4-7;1-3-4-2/h4H,1-3H2,(H2,6,8);4H,3H2,1-2H3 |
| InChIKey | UMBKOEBKFFYDEV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methylethanamine;5-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylethanamine;5-oxopentanamide?
The IUPAC name of N-methylethanamine;5-oxopentanamide (CID 143785346) is N-methylethanamine;5-oxopentanamide.
What is the SMILES notation for N-methylethanamine;5-oxopentanamide?
The canonical SMILES for N-methylethanamine;5-oxopentanamide is CCNC.NC(=O)CCCC=O.
What is the InChIKey of N-methylethanamine;5-oxopentanamide?
The InChIKey is UMBKOEBKFFYDEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C3H9N/c6-5(8)3-1-2-4-7;1-3-4-2/h4H,1-3H2,(H2,6,8);4H,3H2,1-2H3.
What are the key properties of N-methylethanamine;5-oxopentanamide?
N-methylethanamine;5-oxopentanamide has a molecular weight of 174.24 g/mol, XLogP of 0.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylethanamine;5-oxopentanamide is sourced from PubChem (CID 143785346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).