About 17-oxoheptadecanamide
17-oxoheptadecanamide (PubChem CID 54112129) has the molecular formula C17H33NO2
and a molecular weight of 283.46 g/mol. Its IUPAC name is 17-oxoheptadecanamide.
Molecular Properties
| Compound Name | 17-oxoheptadecanamide |
| PubChem CID | 54112129 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 17-oxoheptadecanamide |
| SMILES | NC(=O)CCCCCCCCCCCCCCCC=O |
| InChI | InChI=1S/C17H33NO2/c18-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-19/h16H,1-15H2,(H2,18,20) |
| InChIKey | RKOUTNRDSFCMQU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 17-oxoheptadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 17-oxoheptadecanamide?
The IUPAC name of 17-oxoheptadecanamide (CID 54112129) is 17-oxoheptadecanamide.
What is the SMILES notation for 17-oxoheptadecanamide?
The canonical SMILES for 17-oxoheptadecanamide is NC(=O)CCCCCCCCCCCCCCCC=O.
What is the InChIKey of 17-oxoheptadecanamide?
The InChIKey is RKOUTNRDSFCMQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO2/c18-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-19/h16H,1-15H2,(H2,18,20).
What are the key properties of 17-oxoheptadecanamide?
17-oxoheptadecanamide has a molecular weight of 283.46 g/mol, XLogP of 4.52, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 17-oxoheptadecanamide is sourced from PubChem (CID 54112129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).