About 12-oxododecanamide
12-oxododecanamide (PubChem CID 54019408) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 12-oxododecanamide.
Molecular Properties
| Compound Name | 12-oxododecanamide |
| PubChem CID | 54019408 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 12-oxododecanamide |
| SMILES | NC(=O)CCCCCCCCCCC=O |
| InChI | InChI=1S/C12H23NO2/c13-12(15)10-8-6-4-2-1-3-5-7-9-11-14/h11H,1-10H2,(H2,13,15) |
| InChIKey | YEAYEJKMPKVEGQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-oxododecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-oxododecanamide?
The IUPAC name of 12-oxododecanamide (CID 54019408) is 12-oxododecanamide.
What is the SMILES notation for 12-oxododecanamide?
The canonical SMILES for 12-oxododecanamide is NC(=O)CCCCCCCCCCC=O.
What is the InChIKey of 12-oxododecanamide?
The InChIKey is YEAYEJKMPKVEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c13-12(15)10-8-6-4-2-1-3-5-7-9-11-14/h11H,1-10H2,(H2,13,15).
What are the key properties of 12-oxododecanamide?
12-oxododecanamide has a molecular weight of 213.32 g/mol, XLogP of 2.57, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-oxododecanamide is sourced from PubChem (CID 54019408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).