C8H12F3NO4 — CID 175908161
6-oxohexanamide;2,2,2-trifluoroacetic acid (PubChem CID 175908161) has the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. Its IUPAC name is 6-oxohexanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-oxohexanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175908161 |
| Molecular Formula | C8H12F3NO4 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 6-oxohexanamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)CCCCC=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H11NO2.C2HF3O2/c7-6(9)4-2-1-3-5-8;3-2(4,5)1(6)7/h5H,1-4H2,(H2,7,9);(H,6,7) |
| InChIKey | UILOSCZMKGSYBX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|