About N-methylmethanamine;5-oxohexanal
N-methylmethanamine;5-oxohexanal (PubChem CID 144530013) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is N-methylmethanamine;5-oxohexanal.
Molecular Properties
| Compound Name | N-methylmethanamine;5-oxohexanal |
| PubChem CID | 144530013 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | N-methylmethanamine;5-oxohexanal |
| SMILES | CC(=O)CCCC=O.CNC |
| InChI | InChI=1S/C6H10O2.C2H7N/c1-6(8)4-2-3-5-7;1-3-2/h5H,2-4H2,1H3;3H,1-2H3 |
| InChIKey | HWNOVTPQUCIPHP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;5-oxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;5-oxohexanal?
The IUPAC name of N-methylmethanamine;5-oxohexanal (CID 144530013) is N-methylmethanamine;5-oxohexanal.
What is the SMILES notation for N-methylmethanamine;5-oxohexanal?
The canonical SMILES for N-methylmethanamine;5-oxohexanal is CC(=O)CCCC=O.CNC.
What is the InChIKey of N-methylmethanamine;5-oxohexanal?
The InChIKey is HWNOVTPQUCIPHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C2H7N/c1-6(8)4-2-3-5-7;1-3-2/h5H,2-4H2,1H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;5-oxohexanal?
N-methylmethanamine;5-oxohexanal has a molecular weight of 159.23 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;5-oxohexanal is sourced from PubChem (CID 144530013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).