About butyl 2-(2-methoxybutoxy)ethyl carbonate
butyl 2-(2-methoxybutoxy)ethyl carbonate (PubChem CID 87248025) has the molecular formula C12H24O5
and a molecular weight of 248.32 g/mol. Its IUPAC name is butyl 2-(2-methoxybutoxy)ethyl carbonate.
Molecular Properties
| Compound Name | butyl 2-(2-methoxybutoxy)ethyl carbonate |
| PubChem CID | 87248025 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | butyl 2-(2-methoxybutoxy)ethyl carbonate |
| SMILES | CCCCOC(=O)OCCOCC(CC)OC |
| InChI | InChI=1S/C12H24O5/c1-4-6-7-16-12(13)17-9-8-15-10-11(5-2)14-3/h11H,4-10H2,1-3H3 |
| InChIKey | KAXINJPTUBNITI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-(2-methoxybutoxy)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-(2-methoxybutoxy)ethyl carbonate?
The IUPAC name of butyl 2-(2-methoxybutoxy)ethyl carbonate (CID 87248025) is butyl 2-(2-methoxybutoxy)ethyl carbonate.
What is the SMILES notation for butyl 2-(2-methoxybutoxy)ethyl carbonate?
The canonical SMILES for butyl 2-(2-methoxybutoxy)ethyl carbonate is CCCCOC(=O)OCCOCC(CC)OC.
What is the InChIKey of butyl 2-(2-methoxybutoxy)ethyl carbonate?
The InChIKey is KAXINJPTUBNITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O5/c1-4-6-7-16-12(13)17-9-8-15-10-11(5-2)14-3/h11H,4-10H2,1-3H3.
What are the key properties of butyl 2-(2-methoxybutoxy)ethyl carbonate?
butyl 2-(2-methoxybutoxy)ethyl carbonate has a molecular weight of 248.32 g/mol, XLogP of 2.38, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-(2-methoxybutoxy)ethyl carbonate is sourced from PubChem (CID 87248025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).