About butyl 3-methoxybutyl carbonate
butyl 3-methoxybutyl carbonate (PubChem CID 87247600) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is butyl 3-methoxybutyl carbonate.
Molecular Properties
| Compound Name | butyl 3-methoxybutyl carbonate |
| PubChem CID | 87247600 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | butyl 3-methoxybutyl carbonate |
| SMILES | CCCCOC(=O)OCCC(C)OC |
| InChI | InChI=1S/C10H20O4/c1-4-5-7-13-10(11)14-8-6-9(2)12-3/h9H,4-8H2,1-3H3 |
| InChIKey | IHHHLDXRZABYBA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-methoxybutyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-methoxybutyl carbonate?
The IUPAC name of butyl 3-methoxybutyl carbonate (CID 87247600) is butyl 3-methoxybutyl carbonate.
What is the SMILES notation for butyl 3-methoxybutyl carbonate?
The canonical SMILES for butyl 3-methoxybutyl carbonate is CCCCOC(=O)OCCC(C)OC.
What is the InChIKey of butyl 3-methoxybutyl carbonate?
The InChIKey is IHHHLDXRZABYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-4-5-7-13-10(11)14-8-6-9(2)12-3/h9H,4-8H2,1-3H3.
What are the key properties of butyl 3-methoxybutyl carbonate?
butyl 3-methoxybutyl carbonate has a molecular weight of 204.27 g/mol, XLogP of 2.36, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-methoxybutyl carbonate is sourced from PubChem (CID 87247600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).