C8H20N2O7 — CID 88965625
1-[2,3-bis[(dihydroxyamino)oxy]propoxy]-3-methylbutane (PubChem CID 88965625) has the molecular formula C8H20N2O7 and a molecular weight of 256.25 g/mol. Its IUPAC name is 1-[2,3-bis[(dihydroxyamino)oxy]propoxy]-3-methylbutane.
| Compound Name | 1-[2,3-bis[(dihydroxyamino)oxy]propoxy]-3-methylbutane |
|---|---|
| PubChem CID | 88965625 |
| Molecular Formula | C8H20N2O7 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-[2,3-bis[(dihydroxyamino)oxy]propoxy]-3-methylbutane |
| SMILES | CC(C)CCOCC(CON(O)O)ON(O)O |
| InChI | InChI=1S/C8H20N2O7/c1-7(2)3-4-15-5-8(17-10(13)14)6-16-9(11)12/h7-8,11-14H,3-6H2,1-2H3 |
| InChIKey | UYQNNWABNRYVSC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|