C8H19NO2 — CID 118521701
(2R)-3-ethoxy-2-methoxy-N,N-dimethylpropan-1-amine (PubChem CID 118521701) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is (2R)-3-ethoxy-2-methoxy-N,N-dimethylpropan-1-amine.
| Compound Name | (2R)-3-ethoxy-2-methoxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 118521701 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | (2R)-3-ethoxy-2-methoxy-N,N-dimethylpropan-1-amine |
| SMILES | CCOC[C@@H](CN(C)C)OC |
| InChI | InChI=1S/C8H19NO2/c1-5-11-7-8(10-4)6-9(2)3/h8H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | BPYGZNVADGPYTE-MRVPVSSYSA-N |
| XLogP | 0.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |