C25H53NO4 — CID 91084568
N,N-dimethyl-2,3-bis(nonoxymethoxy)propan-1-amine (PubChem CID 91084568) has the molecular formula C25H53NO4 and a molecular weight of 431.70 g/mol. Its IUPAC name is N,N-dimethyl-2,3-bis(nonoxymethoxy)propan-1-amine.
| Compound Name | N,N-dimethyl-2,3-bis(nonoxymethoxy)propan-1-amine |
|---|---|
| PubChem CID | 91084568 |
| Molecular Formula | C25H53NO4 |
| Molecular Weight | 431.70 g/mol |
| Exact Mass | 431.40 |
| IUPAC Name | N,N-dimethyl-2,3-bis(nonoxymethoxy)propan-1-amine |
| SMILES | CCCCCCCCCOCOCC(CN(C)C)OCOCCCCCCCCC |
| InChI | InChI=1S/C25H53NO4/c1-5-7-9-11-13-15-17-19-27-23-29-22-25(21-26(3)4)30-24-28-20-18-16-14-12-10-8-6-2/h25H,5-24H2,1-4H3 |
| InChIKey | BWRWDZKETUFCLA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|