About 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate
8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate (PubChem CID 58070161) has the molecular formula C39H73NO8
and a molecular weight of 684.01 g/mol. Its IUPAC name is 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate.
Molecular Properties
| Compound Name | 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate |
| PubChem CID | 58070161 |
| Molecular Formula | C39H73NO8 |
| Molecular Weight | 684.01 g/mol |
| Exact Mass | 683.53 |
| IUPAC Name | 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate |
| SMILES | CCCCCCC(=O)CC(=O)OCCCCCCCCOCC(CN(C)C)OCCCCCCCCOC(=O)CC(=O)CCCCCC |
| InChI | InChI=1S/C39H73NO8/c1-5-7-9-19-25-35(41)31-38(43)47-29-23-17-12-11-15-21-27-45-34-37(33-40(3)4)46-28-22-16-13-14-18-24-30-48-39(44)32-36(42)26-20-10-8-6-2/h37H,5-34H2,1-4H3 |
| InChIKey | IDDVFHCCGYIBGB-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 684.01 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate?
The IUPAC name of 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate (CID 58070161) is 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate.
What is the SMILES notation for 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate?
The canonical SMILES for 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate is CCCCCCC(=O)CC(=O)OCCCCCCCCOCC(CN(C)C)OCCCCCCCCOC(=O)CC(=O)CCCCCC.
What is the InChIKey of 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate?
The InChIKey is IDDVFHCCGYIBGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H73NO8/c1-5-7-9-19-25-35(41)31-38(43)47-29-23-17-12-11-15-21-27-45-34-37(33-40(3)4)46-28-22-16-13-14-18-24-30-48-39(44)32-36(42)26-20-10-8-6-2/h37H,5-34H2,1-4H3.
What are the key properties of 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate?
8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate has a molecular weight of 684.01 g/mol, XLogP of 8.58, 37 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[3-(dimethylamino)-2-[8-(3-oxononanoyloxy)octoxy]propoxy]octyl 3-oxononanoate is sourced from PubChem (CID 58070161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).