C40H75NO6 — CID 118591741
[(Z)-non-2-enyl] 9-[4-(dimethylamino)-3-[7-[(Z)-non-2-enoxy]-7-oxoheptoxy]butoxy]nonanoate (PubChem CID 118591741) has the molecular formula C40H75NO6 and a molecular weight of 666.04 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 9-[4-(dimethylamino)-3-[7-[(Z)-non-2-enoxy]-7-oxoheptoxy]butoxy]nonanoate.
| Compound Name | [(Z)-non-2-enyl] 9-[4-(dimethylamino)-3-[7-[(Z)-non-2-enoxy]-7-oxoheptoxy]butoxy]nonanoate |
|---|---|
| PubChem CID | 118591741 |
| Molecular Formula | C40H75NO6 |
| Molecular Weight | 666.04 g/mol |
| Exact Mass | 665.56 |
| IUPAC Name | [(Z)-non-2-enyl] 9-[4-(dimethylamino)-3-[7-[(Z)-non-2-enoxy]-7-oxoheptoxy]butoxy]nonanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCCOCCC(CN(C)C)OCCCCCCC(=O)OC/C=C\CCCCCC |
| InChI | InChI=1S/C40H75NO6/c1-5-7-9-11-14-20-27-34-46-39(42)29-23-17-13-16-19-25-32-44-36-31-38(37-41(3)4)45-33-26-22-18-24-30-40(43)47-35-28-21-15-12-10-8-6-2/h20-21,27-28,38H,5-19,22-26,29-37H2,1-4H3/b27-20-,28-21- |
| InChIKey | CZSMHNBBWVMNHK-IUWSMASESA-N |
| XLogP | 10.16 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.04 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|