C45H83N3O10 — CID 169059670
[(Z)-non-2-enyl] 8-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-[8-[(Z)-non-2-enoxy]-8-oxooctoxy]propoxy]octanoate (PubChem CID 169059670) has the molecular formula C45H83N3O10 and a molecular weight of 826.17 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-[8-[(Z)-non-2-enoxy]-8-oxooctoxy]propoxy]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-[8-[(Z)-non-2-enoxy]-8-oxooctoxy]propoxy]octanoate |
|---|---|
| PubChem CID | 169059670 |
| Molecular Formula | C45H83N3O10 |
| Molecular Weight | 826.17 g/mol |
| Exact Mass | 825.61 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-[8-[(Z)-non-2-enoxy]-8-oxooctoxy]propoxy]octanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCOCC(COCCOCCOCCOCCN=[N+]=[N-])OCCCCCCCC(=O)OC/C=C\CCCCCC |
| InChI | InChI=1S/C45H83N3O10/c1-3-5-7-9-11-18-25-32-57-44(49)27-21-15-13-17-23-30-54-41-43(42-55-40-39-53-38-37-52-36-35-51-34-29-47-48-46)56-31-24-20-14-16-22-28-45(50)58-33-26-19-12-10-8-6-4-2/h18-19,25-26,43H,3-17,20-24,27-42H2,1-2H3/b25-18-,26-19- |
| InChIKey | AJUZHWISVITAQW-HSLKWFPPSA-N |
| XLogP | 10.59 |
| TPSA | 156.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.17 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|