C39H73NO5 — CID 123911089
non-2-enyl 7-[1-(dimethylamino)-4-(7-oxoheptadec-10-enoxy)butan-2-yl]oxyheptanoate (PubChem CID 123911089) has the molecular formula C39H73NO5 and a molecular weight of 636.02 g/mol. Its IUPAC name is non-2-enyl 7-[1-(dimethylamino)-4-(7-oxoheptadec-10-enoxy)butan-2-yl]oxyheptanoate.
| Compound Name | non-2-enyl 7-[1-(dimethylamino)-4-(7-oxoheptadec-10-enoxy)butan-2-yl]oxyheptanoate |
|---|---|
| PubChem CID | 123911089 |
| Molecular Formula | C39H73NO5 |
| Molecular Weight | 636.02 g/mol |
| Exact Mass | 635.55 |
| IUPAC Name | non-2-enyl 7-[1-(dimethylamino)-4-(7-oxoheptadec-10-enoxy)butan-2-yl]oxyheptanoate |
| SMILES | CCCCCCC=CCCC(=O)CCCCCCOCCC(CN(C)C)OCCCCCCC(=O)OCC=CCCCCCC |
| InChI | InChI=1S/C39H73NO5/c1-5-7-9-11-13-14-16-22-28-37(41)29-23-17-20-25-32-43-35-31-38(36-40(3)4)44-33-26-21-18-24-30-39(42)45-34-27-19-15-12-10-8-6-2/h14,16,19,27,38H,5-13,15,17-18,20-26,28-36H2,1-4H3 |
| InChIKey | VJNWGQUPUHBOIB-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.02 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|