C15H33NO2 — CID 123359366
3-ethoxy-N,N-dimethyl-2-octan-4-yloxypropan-1-amine (PubChem CID 123359366) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is 3-ethoxy-N,N-dimethyl-2-octan-4-yloxypropan-1-amine.
| Compound Name | 3-ethoxy-N,N-dimethyl-2-octan-4-yloxypropan-1-amine |
|---|---|
| PubChem CID | 123359366 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 3-ethoxy-N,N-dimethyl-2-octan-4-yloxypropan-1-amine |
| SMILES | CCCCC(CCC)OC(COCC)CN(C)C |
| InChI | InChI=1S/C15H33NO2/c1-6-9-11-14(10-7-2)18-15(12-16(4)5)13-17-8-3/h14-15H,6-13H2,1-5H3 |
| InChIKey | JZDPMOWODMPGBI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |