C10H22O5 — CID 87688301
1-[2-(ethoxymethoxy)ethoxy]-2,3-dimethoxypropane (PubChem CID 87688301) has the molecular formula C10H22O5 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-[2-(ethoxymethoxy)ethoxy]-2,3-dimethoxypropane.
| Compound Name | 1-[2-(ethoxymethoxy)ethoxy]-2,3-dimethoxypropane |
|---|---|
| PubChem CID | 87688301 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-[2-(ethoxymethoxy)ethoxy]-2,3-dimethoxypropane |
| SMILES | CCOCOCCOCC(COC)OC |
| InChI | InChI=1S/C10H22O5/c1-4-13-9-15-6-5-14-8-10(12-3)7-11-2/h10H,4-9H2,1-3H3 |
| InChIKey | VWAIGTDBUZNNFT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|