C9H20O5 — CID 88943505
1,2-dimethoxy-3-(2-methoxyethoxymethoxy)propane (PubChem CID 88943505) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is 1,2-dimethoxy-3-(2-methoxyethoxymethoxy)propane.
| Compound Name | 1,2-dimethoxy-3-(2-methoxyethoxymethoxy)propane |
|---|---|
| PubChem CID | 88943505 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1,2-dimethoxy-3-(2-methoxyethoxymethoxy)propane |
| SMILES | COCCOCOCC(COC)OC |
| InChI | InChI=1S/C9H20O5/c1-10-4-5-13-8-14-7-9(12-3)6-11-2/h9H,4-8H2,1-3H3 |
| InChIKey | SPYTXWVWYRWWSO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|