C12H26O3 — CID 173222858
1-(1,2-diethoxyethoxy)hexane (PubChem CID 173222858) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-(1,2-diethoxyethoxy)hexane.
| Compound Name | 1-(1,2-diethoxyethoxy)hexane |
|---|---|
| PubChem CID | 173222858 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 1-(1,2-diethoxyethoxy)hexane |
| SMILES | CCCCCCOC(COCC)OCC |
| InChI | InChI=1S/C12H26O3/c1-4-7-8-9-10-15-12(14-6-3)11-13-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | VFRHJUNTHDCOBA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|