About (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate
(1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate (PubChem CID 155630613) has the molecular formula C6H13O4P
and a molecular weight of 180.14 g/mol. Its IUPAC name is (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate.
Molecular Properties
| Compound Name | (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate |
| PubChem CID | 155630613 |
| Molecular Formula | C6H13O4P |
| Molecular Weight | 180.14 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate |
| SMILES | CCOCC(CO)OC(=O)P |
| InChI | InChI=1S/C6H13O4P/c1-2-9-4-5(3-7)10-6(8)11/h5,7H,2-4,11H2,1H3 |
| InChIKey | HAVBPFVBQVFPFQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.14 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate?
The IUPAC name of (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate (CID 155630613) is (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate.
What is the SMILES notation for (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate?
The canonical SMILES for (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate is CCOCC(CO)OC(=O)P.
What is the InChIKey of (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate?
The InChIKey is HAVBPFVBQVFPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O4P/c1-2-9-4-5(3-7)10-6(8)11/h5,7H,2-4,11H2,1H3.
What are the key properties of (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate?
(1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate has a molecular weight of 180.14 g/mol, XLogP of 0.40, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-3-hydroxypropan-2-yl) phosphanylformate is sourced from PubChem (CID 155630613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).