C18H42O11 — CID 159242231
ethane;3-(1-ethoxy-3-hydroxypropan-2-yl)oxypropane-1,2-diol;1-[(3-ethoxy-2-hydroxypropoxy)methoxy]ethane-1,2-diol (PubChem CID 159242231) has the molecular formula C18H42O11 and a molecular weight of 434.52 g/mol. Its IUPAC name is ethane;3-(1-ethoxy-3-hydroxypropan-2-yl)oxypropane-1,2-diol;1-[(3-ethoxy-2-hydroxypropoxy)methoxy]ethane-1,2-diol.
| Compound Name | ethane;3-(1-ethoxy-3-hydroxypropan-2-yl)oxypropane-1,2-diol;1-[(3-ethoxy-2-hydroxypropoxy)methoxy]ethane-1,2-diol |
|---|---|
| PubChem CID | 159242231 |
| Molecular Formula | C18H42O11 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | ethane;3-(1-ethoxy-3-hydroxypropan-2-yl)oxypropane-1,2-diol;1-[(3-ethoxy-2-hydroxypropoxy)methoxy]ethane-1,2-diol |
| SMILES | CC.CCOCC(CO)OCC(O)CO.CCOCC(O)COCOC(O)CO |
| InChI | InChI=1S/C8H18O6.C8H18O5.C2H6/c1-2-12-4-7(10)5-13-6-14-8(11)3-9;1-2-12-6-8(4-10)13-5-7(11)3-9;1-2/h7-11H,2-6H2,1H3;7-11H,2-6H2,1H3;1-2H3 |
| InChIKey | KUFVRTGHQIRTMW-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|