C10H24O4 — CID 158153184
2,3-diethoxybutane;ethane-1,2-diol (PubChem CID 158153184) has the molecular formula C10H24O4 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,3-diethoxybutane;ethane-1,2-diol.
| Compound Name | 2,3-diethoxybutane;ethane-1,2-diol |
|---|---|
| PubChem CID | 158153184 |
| Molecular Formula | C10H24O4 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 2,3-diethoxybutane;ethane-1,2-diol |
| SMILES | CCOC(C)C(C)OCC.OCCO |
| InChI | InChI=1S/C8H18O2.C2H6O2/c1-5-9-7(3)8(4)10-6-2;3-1-2-4/h7-8H,5-6H2,1-4H3;3-4H,1-2H2 |
| InChIKey | FVJDPARTVRJZQP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |