C11H24O3 — CID 129365387
(2R,3R)-1,1,3-triethoxy-2-methylbutane (PubChem CID 129365387) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is (2R,3R)-1,1,3-triethoxy-2-methylbutane.
| Compound Name | (2R,3R)-1,1,3-triethoxy-2-methylbutane |
|---|---|
| PubChem CID | 129365387 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | (2R,3R)-1,1,3-triethoxy-2-methylbutane |
| SMILES | CCOC(OCC)[C@H](C)[C@@H](C)OCC |
| InChI | InChI=1S/C11H24O3/c1-6-12-10(5)9(4)11(13-7-2)14-8-3/h9-11H,6-8H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | BWDYLUMZXQQYHK-NXEZZACHSA-N |
| XLogP | 2.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|