C12H27NO2 — CID 83160850
1,1-diethoxy-6-methylheptan-2-amine (PubChem CID 83160850) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 1,1-diethoxy-6-methylheptan-2-amine.
| Compound Name | 1,1-diethoxy-6-methylheptan-2-amine |
|---|---|
| PubChem CID | 83160850 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1,1-diethoxy-6-methylheptan-2-amine |
| SMILES | CCOC(OCC)C(N)CCCC(C)C |
| InChI | InChI=1S/C12H27NO2/c1-5-14-12(15-6-2)11(13)9-7-8-10(3)4/h10-12H,5-9,13H2,1-4H3 |
| InChIKey | CEBSVAUAQXOABB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|