C8H19NO2 — CID 79574517
1,3-diethoxybutan-2-amine (PubChem CID 79574517) has the molecular formula C8H19NO2 and a molecular weight of 161.24 g/mol. Its IUPAC name is 1,3-diethoxybutan-2-amine.
| Compound Name | 1,3-diethoxybutan-2-amine |
|---|---|
| PubChem CID | 79574517 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 1,3-diethoxybutan-2-amine |
| SMILES | CCOCC(N)C(C)OCC |
| InChI | InChI=1S/C8H19NO2/c1-4-10-6-8(9)7(3)11-5-2/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | DUVIKUHGPQPUCB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |