About diethoxymethanamine;hydrochloride
diethoxymethanamine;hydrochloride (PubChem CID 175125355) has the molecular formula C5H14ClNO2
and a molecular weight of 155.62 g/mol. Its IUPAC name is diethoxymethanamine;hydrochloride.
Molecular Properties
| Compound Name | diethoxymethanamine;hydrochloride |
| PubChem CID | 175125355 |
| Molecular Formula | C5H14ClNO2 |
| Molecular Weight | 155.62 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | diethoxymethanamine;hydrochloride |
| SMILES | CCOC(N)OCC.Cl |
| InChI | InChI=1S/C5H13NO2.ClH/c1-3-7-5(6)8-4-2;/h5H,3-4,6H2,1-2H3;1H |
| InChIKey | HQPAIEWENLUUEJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.62 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diethoxymethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxymethanamine;hydrochloride?
The IUPAC name of diethoxymethanamine;hydrochloride (CID 175125355) is diethoxymethanamine;hydrochloride.
What is the SMILES notation for diethoxymethanamine;hydrochloride?
The canonical SMILES for diethoxymethanamine;hydrochloride is CCOC(N)OCC.Cl.
What is the InChIKey of diethoxymethanamine;hydrochloride?
The InChIKey is HQPAIEWENLUUEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.ClH/c1-3-7-5(6)8-4-2;/h5H,3-4,6H2,1-2H3;1H.
What are the key properties of diethoxymethanamine;hydrochloride?
diethoxymethanamine;hydrochloride has a molecular weight of 155.62 g/mol, XLogP of 0.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxymethanamine;hydrochloride is sourced from PubChem (CID 175125355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).