About cyclopropane;diethoxymethanamine
cyclopropane;diethoxymethanamine (PubChem CID 67531002) has the molecular formula C8H19NO2
and a molecular weight of 161.24 g/mol. Its IUPAC name is cyclopropane;diethoxymethanamine.
Molecular Properties
| Compound Name | cyclopropane;diethoxymethanamine |
| PubChem CID | 67531002 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | cyclopropane;diethoxymethanamine |
| SMILES | C1CC1.CCOC(N)OCC |
| InChI | InChI=1S/C5H13NO2.C3H6/c1-3-7-5(6)8-4-2;1-2-3-1/h5H,3-4,6H2,1-2H3;1-3H2 |
| InChIKey | RDCTZUYLKMNVNW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;diethoxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;diethoxymethanamine?
The IUPAC name of cyclopropane;diethoxymethanamine (CID 67531002) is cyclopropane;diethoxymethanamine.
What is the SMILES notation for cyclopropane;diethoxymethanamine?
The canonical SMILES for cyclopropane;diethoxymethanamine is C1CC1.CCOC(N)OCC.
What is the InChIKey of cyclopropane;diethoxymethanamine?
The InChIKey is RDCTZUYLKMNVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.C3H6/c1-3-7-5(6)8-4-2;1-2-3-1/h5H,3-4,6H2,1-2H3;1-3H2.
What are the key properties of cyclopropane;diethoxymethanamine?
cyclopropane;diethoxymethanamine has a molecular weight of 161.24 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;diethoxymethanamine is sourced from PubChem (CID 67531002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).