C8H21NO2Si — CID 174746425
1,1-diethoxy-4-silylbutan-2-amine (PubChem CID 174746425) has the molecular formula C8H21NO2Si and a molecular weight of 191.35 g/mol. Its IUPAC name is 1,1-diethoxy-4-silylbutan-2-amine.
| Compound Name | 1,1-diethoxy-4-silylbutan-2-amine |
|---|---|
| PubChem CID | 174746425 |
| Molecular Formula | C8H21NO2Si |
| Molecular Weight | 191.35 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1,1-diethoxy-4-silylbutan-2-amine |
| SMILES | CCOC(OCC)C(N)CC[SiH3] |
| InChI | InChI=1S/C8H21NO2Si/c1-3-10-8(11-4-2)7(9)5-6-12/h7-8H,3-6,9H2,1-2,12H3 |
| InChIKey | ZMSCFLCLDPBZRU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|