About 3-ethoxy-2,2,7-trimethyloctan-4-amine
3-ethoxy-2,2,7-trimethyloctan-4-amine (PubChem CID 116725152) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is 3-ethoxy-2,2,7-trimethyloctan-4-amine.
Molecular Properties
| Compound Name | 3-ethoxy-2,2,7-trimethyloctan-4-amine |
| PubChem CID | 116725152 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 3-ethoxy-2,2,7-trimethyloctan-4-amine |
| SMILES | CCOC(C(N)CCC(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29NO/c1-7-15-12(13(4,5)6)11(14)9-8-10(2)3/h10-12H,7-9,14H2,1-6H3 |
| InChIKey | WHTNVYDZYXNINC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-2,2,7-trimethyloctan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,2,7-trimethyloctan-4-amine?
The IUPAC name of 3-ethoxy-2,2,7-trimethyloctan-4-amine (CID 116725152) is 3-ethoxy-2,2,7-trimethyloctan-4-amine.
What is the SMILES notation for 3-ethoxy-2,2,7-trimethyloctan-4-amine?
The canonical SMILES for 3-ethoxy-2,2,7-trimethyloctan-4-amine is CCOC(C(N)CCC(C)C)C(C)(C)C.
What is the InChIKey of 3-ethoxy-2,2,7-trimethyloctan-4-amine?
The InChIKey is WHTNVYDZYXNINC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO/c1-7-15-12(13(4,5)6)11(14)9-8-10(2)3/h10-12H,7-9,14H2,1-6H3.
What are the key properties of 3-ethoxy-2,2,7-trimethyloctan-4-amine?
3-ethoxy-2,2,7-trimethyloctan-4-amine has a molecular weight of 215.38 g/mol, XLogP of 3.20, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,2,7-trimethyloctan-4-amine is sourced from PubChem (CID 116725152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).