C10H23NO — CID 104932287
(3S)-4-ethoxy-5,5-dimethylhexan-3-amine (PubChem CID 104932287) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is (3S)-4-ethoxy-5,5-dimethylhexan-3-amine.
| Compound Name | (3S)-4-ethoxy-5,5-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 104932287 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | (3S)-4-ethoxy-5,5-dimethylhexan-3-amine |
| SMILES | CCOC([C@@H](N)CC)C(C)(C)C |
| InChI | InChI=1S/C10H23NO/c1-6-8(11)9(12-7-2)10(3,4)5/h8-9H,6-7,11H2,1-5H3/t8-,9?/m0/s1 |
| InChIKey | NWYKVBUICAGKOE-IENPIDJESA-N |
| XLogP | 2.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |