About 1-ethoxypentan-2-amine
1-ethoxypentan-2-amine (PubChem CID 62042543) has the molecular formula C7H17NO
and a molecular weight of 131.22 g/mol. Its IUPAC name is 1-ethoxypentan-2-amine.
Molecular Properties
| Compound Name | 1-ethoxypentan-2-amine |
| PubChem CID | 62042543 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | 1-ethoxypentan-2-amine |
| SMILES | CCCC(N)COCC |
| InChI | InChI=1S/C7H17NO/c1-3-5-7(8)6-9-4-2/h7H,3-6,8H2,1-2H3 |
| InChIKey | ZFAGKVSENLSINU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethoxypentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypentan-2-amine?
The IUPAC name of 1-ethoxypentan-2-amine (CID 62042543) is 1-ethoxypentan-2-amine.
What is the SMILES notation for 1-ethoxypentan-2-amine?
The canonical SMILES for 1-ethoxypentan-2-amine is CCCC(N)COCC.
What is the InChIKey of 1-ethoxypentan-2-amine?
The InChIKey is ZFAGKVSENLSINU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO/c1-3-5-7(8)6-9-4-2/h7H,3-6,8H2,1-2H3.
What are the key properties of 1-ethoxypentan-2-amine?
1-ethoxypentan-2-amine has a molecular weight of 131.22 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypentan-2-amine is sourced from PubChem (CID 62042543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).