About dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane
dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane (PubChem CID 159144629) has the molecular formula C17H36O8
and a molecular weight of 368.47 g/mol. Its IUPAC name is dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane.
Molecular Properties
| Compound Name | dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane |
| PubChem CID | 159144629 |
| Molecular Formula | C17H36O8 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane |
| SMILES | C.CCOC(CC(=O)OC)CC(=O)OC.CCOC(CCO)CCO |
| InChI | InChI=1S/C9H16O5.C7H16O3.CH4/c1-4-14-7(5-8(10)12-2)6-9(11)13-3;1-2-10-7(3-5-8)4-6-9;/h7H,4-6H2,1-3H3;7-9H,2-6H2,1H3;1H4 |
| InChIKey | KINHVMDIMPETDG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane?
The IUPAC name of dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane (CID 159144629) is dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane.
What is the SMILES notation for dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane?
The canonical SMILES for dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane is C.CCOC(CC(=O)OC)CC(=O)OC.CCOC(CCO)CCO.
What is the InChIKey of dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane?
The InChIKey is KINHVMDIMPETDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5.C7H16O3.CH4/c1-4-14-7(5-8(10)12-2)6-9(11)13-3;1-2-10-7(3-5-8)4-6-9;/h7H,4-6H2,1-3H3;7-9H,2-6H2,1H3;1H4.
What are the key properties of dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane?
dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane has a molecular weight of 368.47 g/mol, XLogP of 1.31, 12 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-ethoxypentanedioate;3-ethoxypentane-1,5-diol;methane is sourced from PubChem (CID 159144629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).