About dimethyl 3-pentoxypentanedioate
dimethyl 3-pentoxypentanedioate (PubChem CID 87950297) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is dimethyl 3-pentoxypentanedioate.
Molecular Properties
| Compound Name | dimethyl 3-pentoxypentanedioate |
| PubChem CID | 87950297 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | dimethyl 3-pentoxypentanedioate |
| SMILES | CCCCCOC(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C12H22O5/c1-4-5-6-7-17-10(8-11(13)15-2)9-12(14)16-3/h10H,4-9H2,1-3H3 |
| InChIKey | NHXVJPBOSUPDOW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3-pentoxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-pentoxypentanedioate?
The IUPAC name of dimethyl 3-pentoxypentanedioate (CID 87950297) is dimethyl 3-pentoxypentanedioate.
What is the SMILES notation for dimethyl 3-pentoxypentanedioate?
The canonical SMILES for dimethyl 3-pentoxypentanedioate is CCCCCOC(CC(=O)OC)CC(=O)OC.
What is the InChIKey of dimethyl 3-pentoxypentanedioate?
The InChIKey is NHXVJPBOSUPDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O5/c1-4-5-6-7-17-10(8-11(13)15-2)9-12(14)16-3/h10H,4-9H2,1-3H3.
What are the key properties of dimethyl 3-pentoxypentanedioate?
dimethyl 3-pentoxypentanedioate has a molecular weight of 246.30 g/mol, XLogP of 1.69, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-pentoxypentanedioate is sourced from PubChem (CID 87950297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).