About methyl 2-dodecoxypropanoate
methyl 2-dodecoxypropanoate (PubChem CID 86244254) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is methyl 2-dodecoxypropanoate.
Molecular Properties
| Compound Name | methyl 2-dodecoxypropanoate |
| PubChem CID | 86244254 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | methyl 2-dodecoxypropanoate |
| SMILES | CCCCCCCCCCCCOC(C)C(=O)OC |
| InChI | InChI=1S/C16H32O3/c1-4-5-6-7-8-9-10-11-12-13-14-19-15(2)16(17)18-3/h15H,4-14H2,1-3H3 |
| InChIKey | COWGMUAUHOLIQF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-dodecoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-dodecoxypropanoate?
The IUPAC name of methyl 2-dodecoxypropanoate (CID 86244254) is methyl 2-dodecoxypropanoate.
What is the SMILES notation for methyl 2-dodecoxypropanoate?
The canonical SMILES for methyl 2-dodecoxypropanoate is CCCCCCCCCCCCOC(C)C(=O)OC.
What is the InChIKey of methyl 2-dodecoxypropanoate?
The InChIKey is COWGMUAUHOLIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-4-5-6-7-8-9-10-11-12-13-14-19-15(2)16(17)18-3/h15H,4-14H2,1-3H3.
What are the key properties of methyl 2-dodecoxypropanoate?
methyl 2-dodecoxypropanoate has a molecular weight of 272.43 g/mol, XLogP of 4.49, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-dodecoxypropanoate is sourced from PubChem (CID 86244254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).