About 2-pentoxypropanamide
2-pentoxypropanamide (PubChem CID 62900296) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-pentoxypropanamide.
Molecular Properties
| Compound Name | 2-pentoxypropanamide |
| PubChem CID | 62900296 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2-pentoxypropanamide |
| SMILES | CCCCCOC(C)C(N)=O |
| InChI | InChI=1S/C8H17NO2/c1-3-4-5-6-11-7(2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | DRXWYAMKPPQNQT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentoxypropanamide?
The IUPAC name of 2-pentoxypropanamide (CID 62900296) is 2-pentoxypropanamide.
What is the SMILES notation for 2-pentoxypropanamide?
The canonical SMILES for 2-pentoxypropanamide is CCCCCOC(C)C(N)=O.
What is the InChIKey of 2-pentoxypropanamide?
The InChIKey is DRXWYAMKPPQNQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-3-4-5-6-11-7(2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10).
What are the key properties of 2-pentoxypropanamide?
2-pentoxypropanamide has a molecular weight of 159.23 g/mol, XLogP of 1.07, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentoxypropanamide is sourced from PubChem (CID 62900296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).