About ethyl 2-nonoxypropanoate
ethyl 2-nonoxypropanoate (PubChem CID 88680880) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is ethyl 2-nonoxypropanoate.
Molecular Properties
| Compound Name | ethyl 2-nonoxypropanoate |
| PubChem CID | 88680880 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | ethyl 2-nonoxypropanoate |
| SMILES | CCCCCCCCCOC(C)C(=O)OCC |
| InChI | InChI=1S/C14H28O3/c1-4-6-7-8-9-10-11-12-17-13(3)14(15)16-5-2/h13H,4-12H2,1-3H3 |
| InChIKey | GEZHONYGMQJZQB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-nonoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-nonoxypropanoate?
The IUPAC name of ethyl 2-nonoxypropanoate (CID 88680880) is ethyl 2-nonoxypropanoate.
What is the SMILES notation for ethyl 2-nonoxypropanoate?
The canonical SMILES for ethyl 2-nonoxypropanoate is CCCCCCCCCOC(C)C(=O)OCC.
What is the InChIKey of ethyl 2-nonoxypropanoate?
The InChIKey is GEZHONYGMQJZQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3/c1-4-6-7-8-9-10-11-12-17-13(3)14(15)16-5-2/h13H,4-12H2,1-3H3.
What are the key properties of ethyl 2-nonoxypropanoate?
ethyl 2-nonoxypropanoate has a molecular weight of 244.37 g/mol, XLogP of 3.71, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-nonoxypropanoate is sourced from PubChem (CID 88680880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).