About ethyl 2-fluoro-2-octoxyacetate
ethyl 2-fluoro-2-octoxyacetate (PubChem CID 79357216) has the molecular formula C12H23FO3
and a molecular weight of 234.31 g/mol. Its IUPAC name is ethyl 2-fluoro-2-octoxyacetate.
Molecular Properties
| Compound Name | ethyl 2-fluoro-2-octoxyacetate |
| PubChem CID | 79357216 |
| Molecular Formula | C12H23FO3 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | ethyl 2-fluoro-2-octoxyacetate |
| SMILES | CCCCCCCCOC(F)C(=O)OCC |
| InChI | InChI=1S/C12H23FO3/c1-3-5-6-7-8-9-10-16-11(13)12(14)15-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | LWZKGICSEDNRNS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-fluoro-2-octoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-2-octoxyacetate?
The IUPAC name of ethyl 2-fluoro-2-octoxyacetate (CID 79357216) is ethyl 2-fluoro-2-octoxyacetate.
What is the SMILES notation for ethyl 2-fluoro-2-octoxyacetate?
The canonical SMILES for ethyl 2-fluoro-2-octoxyacetate is CCCCCCCCOC(F)C(=O)OCC.
What is the InChIKey of ethyl 2-fluoro-2-octoxyacetate?
The InChIKey is LWZKGICSEDNRNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23FO3/c1-3-5-6-7-8-9-10-16-11(13)12(14)15-4-2/h11H,3-10H2,1-2H3.
What are the key properties of ethyl 2-fluoro-2-octoxyacetate?
ethyl 2-fluoro-2-octoxyacetate has a molecular weight of 234.31 g/mol, XLogP of 3.22, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-2-octoxyacetate is sourced from PubChem (CID 79357216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).