About 2-ethoxy-2-octoxyacetic acid
2-ethoxy-2-octoxyacetic acid (PubChem CID 122612440) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-ethoxy-2-octoxyacetic acid.
Molecular Properties
| Compound Name | 2-ethoxy-2-octoxyacetic acid |
| PubChem CID | 122612440 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-ethoxy-2-octoxyacetic acid |
| SMILES | CCCCCCCCOC(OCC)C(=O)O |
| InChI | InChI=1S/C12H24O4/c1-3-5-6-7-8-9-10-16-12(11(13)14)15-4-2/h12H,3-10H2,1-2H3,(H,13,14) |
| InChIKey | SGTFRMMYCHDMIB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-2-octoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-2-octoxyacetic acid?
The IUPAC name of 2-ethoxy-2-octoxyacetic acid (CID 122612440) is 2-ethoxy-2-octoxyacetic acid.
What is the SMILES notation for 2-ethoxy-2-octoxyacetic acid?
The canonical SMILES for 2-ethoxy-2-octoxyacetic acid is CCCCCCCCOC(OCC)C(=O)O.
What is the InChIKey of 2-ethoxy-2-octoxyacetic acid?
The InChIKey is SGTFRMMYCHDMIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4/c1-3-5-6-7-8-9-10-16-12(11(13)14)15-4-2/h12H,3-10H2,1-2H3,(H,13,14).
What are the key properties of 2-ethoxy-2-octoxyacetic acid?
2-ethoxy-2-octoxyacetic acid has a molecular weight of 232.32 g/mol, XLogP of 2.81, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-2-octoxyacetic acid is sourced from PubChem (CID 122612440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).