About 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid)
1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid) (PubChem CID 87357285) has the molecular formula C12H28N2O4S2
and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid).
Molecular Properties
| Compound Name | 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid) |
| PubChem CID | 87357285 |
| Molecular Formula | C12H28N2O4S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid) |
| SMILES | CCCCOC(C)OCCCC.NC(=O)S.NC(=O)S |
| InChI | InChI=1S/C10H22O2.2CH3NOS/c1-4-6-8-11-10(3)12-9-7-5-2;2*2-1(3)4/h10H,4-9H2,1-3H3;2*(H3,2,3,4) |
| InChIKey | NYRFEANRBAAKJU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid)?
The IUPAC name of 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid) (CID 87357285) is 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid).
What is the SMILES notation for 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid)?
The canonical SMILES for 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid) is CCCCOC(C)OCCCC.NC(=O)S.NC(=O)S.
What is the InChIKey of 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid)?
The InChIKey is NYRFEANRBAAKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2.2CH3NOS/c1-4-6-8-11-10(3)12-9-7-5-2;2*2-1(3)4/h10H,4-9H2,1-3H3;2*(H3,2,3,4).
What are the key properties of 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid)?
1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid) has a molecular weight of 328.50 g/mol, XLogP of 2.96, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-butoxyethoxy)butane;bis(carbamothioic S-acid) is sourced from PubChem (CID 87357285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).