About 2-(1-butoxyethoxy)ethanol;pentan-1-ol
2-(1-butoxyethoxy)ethanol;pentan-1-ol (PubChem CID 88518213) has the molecular formula C13H30O4
and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-(1-butoxyethoxy)ethanol;pentan-1-ol.
Molecular Properties
| Compound Name | 2-(1-butoxyethoxy)ethanol;pentan-1-ol |
| PubChem CID | 88518213 |
| Molecular Formula | C13H30O4 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 2-(1-butoxyethoxy)ethanol;pentan-1-ol |
| SMILES | CCCCCO.CCCCOC(C)OCCO |
| InChI | InChI=1S/C8H18O3.C5H12O/c1-3-4-6-10-8(2)11-7-5-9;1-2-3-4-5-6/h8-9H,3-7H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | OHWHKBIVUGLDDF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-butoxyethoxy)ethanol;pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butoxyethoxy)ethanol;pentan-1-ol?
The IUPAC name of 2-(1-butoxyethoxy)ethanol;pentan-1-ol (CID 88518213) is 2-(1-butoxyethoxy)ethanol;pentan-1-ol.
What is the SMILES notation for 2-(1-butoxyethoxy)ethanol;pentan-1-ol?
The canonical SMILES for 2-(1-butoxyethoxy)ethanol;pentan-1-ol is CCCCCO.CCCCOC(C)OCCO.
What is the InChIKey of 2-(1-butoxyethoxy)ethanol;pentan-1-ol?
The InChIKey is OHWHKBIVUGLDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3.C5H12O/c1-3-4-6-10-8(2)11-7-5-9;1-2-3-4-5-6/h8-9H,3-7H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of 2-(1-butoxyethoxy)ethanol;pentan-1-ol?
2-(1-butoxyethoxy)ethanol;pentan-1-ol has a molecular weight of 250.38 g/mol, XLogP of 2.33, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butoxyethoxy)ethanol;pentan-1-ol is sourced from PubChem (CID 88518213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).