About 1-butoxyoctane-1,8-diol
1-butoxyoctane-1,8-diol (PubChem CID 87774765) has the molecular formula C12H26O3
and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-butoxyoctane-1,8-diol.
Molecular Properties
| Compound Name | 1-butoxyoctane-1,8-diol |
| PubChem CID | 87774765 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 1-butoxyoctane-1,8-diol |
| SMILES | CCCCOC(O)CCCCCCCO |
| InChI | InChI=1S/C12H26O3/c1-2-3-11-15-12(14)9-7-5-4-6-8-10-13/h12-14H,2-11H2,1H3 |
| InChIKey | BYJJRBWCFVZPMN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxyoctane-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxyoctane-1,8-diol?
The IUPAC name of 1-butoxyoctane-1,8-diol (CID 87774765) is 1-butoxyoctane-1,8-diol.
What is the SMILES notation for 1-butoxyoctane-1,8-diol?
The canonical SMILES for 1-butoxyoctane-1,8-diol is CCCCOC(O)CCCCCCCO.
What is the InChIKey of 1-butoxyoctane-1,8-diol?
The InChIKey is BYJJRBWCFVZPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3/c1-2-3-11-15-12(14)9-7-5-4-6-8-10-13/h12-14H,2-11H2,1H3.
What are the key properties of 1-butoxyoctane-1,8-diol?
1-butoxyoctane-1,8-diol has a molecular weight of 218.34 g/mol, XLogP of 2.45, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxyoctane-1,8-diol is sourced from PubChem (CID 87774765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).