C16H34O6 — CID 88896545
1-[8-hydroxy-3-(2-hydroxyethoxy)octoxy]hexane-1,6-diol (PubChem CID 88896545) has the molecular formula C16H34O6 and a molecular weight of 322.44 g/mol. Its IUPAC name is 1-[8-hydroxy-3-(2-hydroxyethoxy)octoxy]hexane-1,6-diol.
| Compound Name | 1-[8-hydroxy-3-(2-hydroxyethoxy)octoxy]hexane-1,6-diol |
|---|---|
| PubChem CID | 88896545 |
| Molecular Formula | C16H34O6 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[8-hydroxy-3-(2-hydroxyethoxy)octoxy]hexane-1,6-diol |
| SMILES | OCCCCCC(O)OCCC(CCCCCO)OCCO |
| InChI | InChI=1S/C16H34O6/c17-10-5-1-3-7-15(21-14-12-19)9-13-22-16(20)8-4-2-6-11-18/h15-20H,1-14H2 |
| InChIKey | WCMVCXZSFNRHOV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|