About 1-(2-hydroxyethoxy)butane-1,4-diol
1-(2-hydroxyethoxy)butane-1,4-diol (PubChem CID 57013926) has the molecular formula C6H14O4
and a molecular weight of 150.17 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)butane-1,4-diol.
Molecular Properties
| Compound Name | 1-(2-hydroxyethoxy)butane-1,4-diol |
| PubChem CID | 57013926 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-(2-hydroxyethoxy)butane-1,4-diol |
| SMILES | OCCCC(O)OCCO |
| InChI | InChI=1S/C6H14O4/c7-3-1-2-6(9)10-5-4-8/h6-9H,1-5H2 |
| InChIKey | CSDGKGTXOXZCML-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethoxy)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethoxy)butane-1,4-diol?
The IUPAC name of 1-(2-hydroxyethoxy)butane-1,4-diol (CID 57013926) is 1-(2-hydroxyethoxy)butane-1,4-diol.
What is the SMILES notation for 1-(2-hydroxyethoxy)butane-1,4-diol?
The canonical SMILES for 1-(2-hydroxyethoxy)butane-1,4-diol is OCCCC(O)OCCO.
What is the InChIKey of 1-(2-hydroxyethoxy)butane-1,4-diol?
The InChIKey is CSDGKGTXOXZCML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O4/c7-3-1-2-6(9)10-5-4-8/h6-9H,1-5H2.
What are the key properties of 1-(2-hydroxyethoxy)butane-1,4-diol?
1-(2-hydroxyethoxy)butane-1,4-diol has a molecular weight of 150.17 g/mol, XLogP of -0.91, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethoxy)butane-1,4-diol is sourced from PubChem (CID 57013926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).