About 1,4-dihydroxybutyl carbamate
1,4-dihydroxybutyl carbamate (PubChem CID 141447044) has the molecular formula C5H11NO4
and a molecular weight of 149.15 g/mol. Its IUPAC name is 1,4-dihydroxybutyl carbamate.
Molecular Properties
| Compound Name | 1,4-dihydroxybutyl carbamate |
| PubChem CID | 141447044 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 1,4-dihydroxybutyl carbamate |
| SMILES | NC(=O)OC(O)CCCO |
| InChI | InChI=1S/C5H11NO4/c6-5(9)10-4(8)2-1-3-7/h4,7-8H,1-3H2,(H2,6,9) |
| InChIKey | OGDCIVIKUJCWTG-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydroxybutyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroxybutyl carbamate?
The IUPAC name of 1,4-dihydroxybutyl carbamate (CID 141447044) is 1,4-dihydroxybutyl carbamate.
What is the SMILES notation for 1,4-dihydroxybutyl carbamate?
The canonical SMILES for 1,4-dihydroxybutyl carbamate is NC(=O)OC(O)CCCO.
What is the InChIKey of 1,4-dihydroxybutyl carbamate?
The InChIKey is OGDCIVIKUJCWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO4/c6-5(9)10-4(8)2-1-3-7/h4,7-8H,1-3H2,(H2,6,9).
What are the key properties of 1,4-dihydroxybutyl carbamate?
1,4-dihydroxybutyl carbamate has a molecular weight of 149.15 g/mol, XLogP of -0.83, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroxybutyl carbamate is sourced from PubChem (CID 141447044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).