C16H30O12 — CID 134284088
1-O-(1,4-dihydroxybutyl) 6-O-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] hexanedioate (PubChem CID 134284088) has the molecular formula C16H30O12 and a molecular weight of 414.40 g/mol. Its IUPAC name is 1-O-(1,4-dihydroxybutyl) 6-O-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] hexanedioate.
| Compound Name | 1-O-(1,4-dihydroxybutyl) 6-O-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] hexanedioate |
|---|---|
| PubChem CID | 134284088 |
| Molecular Formula | C16H30O12 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-O-(1,4-dihydroxybutyl) 6-O-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] hexanedioate |
| SMILES | O=C(CCCCC(=O)OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)OC(O)CCCO |
| InChI | InChI=1S/C16H30O12/c17-7-3-6-11(21)27-10(20)4-1-2-5-12(22)28-16(26)15(25)14(24)13(23)9(19)8-18/h9,11,13-19,21,23-26H,1-8H2/t9-,11?,13-,14+,15-,16?/m1/s1 |
| InChIKey | PWZWHPUEGIDNFX-VVOGJUTDSA-N |
| XLogP | -3.52 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|