C34H62O20 — CID 175347428
bis(bis(1,4-dihydroxybutyl) butanedioate);decanedioic acid (PubChem CID 175347428) has the molecular formula C34H62O20 and a molecular weight of 790.85 g/mol. Its IUPAC name is bis(bis(1,4-dihydroxybutyl) butanedioate);decanedioic acid.
| Compound Name | bis(bis(1,4-dihydroxybutyl) butanedioate);decanedioic acid |
|---|---|
| PubChem CID | 175347428 |
| Molecular Formula | C34H62O20 |
| Molecular Weight | 790.85 g/mol |
| Exact Mass | 790.38 |
| IUPAC Name | bis(bis(1,4-dihydroxybutyl) butanedioate);decanedioic acid |
| SMILES | O=C(CCC(=O)OC(O)CCCO)OC(O)CCCO.O=C(CCC(=O)OC(O)CCCO)OC(O)CCCO.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/2C12H22O8.C10H18O4/c2*13-7-1-3-9(15)19-11(17)5-6-12(18)20-10(16)4-2-8-14;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h2*9-10,13-16H,1-8H2;1-8H2,(H,11,12)(H,13,14) |
| InChIKey | BOKPOMIZXIUUHK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 341.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.85 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|