C18H22O9 — CID 174534732
6-[4-(1,4-dihydroxybutoxycarbonyl)benzoyl]oxy-6-oxohexanoic acid (PubChem CID 174534732) has the molecular formula C18H22O9 and a molecular weight of 382.37 g/mol. Its IUPAC name is 6-[4-(1,4-dihydroxybutoxycarbonyl)benzoyl]oxy-6-oxohexanoic acid.
| Compound Name | 6-[4-(1,4-dihydroxybutoxycarbonyl)benzoyl]oxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 174534732 |
| Molecular Formula | C18H22O9 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-[4-(1,4-dihydroxybutoxycarbonyl)benzoyl]oxy-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)OC(=O)c1ccc(C(=O)OC(O)CCCO)cc1 |
| InChI | InChI=1S/C18H22O9/c19-11-3-6-16(23)27-18(25)13-9-7-12(8-10-13)17(24)26-15(22)5-2-1-4-14(20)21/h7-10,16,19,23H,1-6,11H2,(H,20,21) |
| InChIKey | MTAMCQCNQKPLOW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|