C25H28O13 — CID 174877234
1-O-[6-[(Z)-4-(4-hydroxybutoxy)-4-oxobut-2-enoyl]oxy-6-oxohexanoyl] 4-O-(2-hydroxypropanoyl) benzene-1,4-dicarboxylate (PubChem CID 174877234) has the molecular formula C25H28O13 and a molecular weight of 536.49 g/mol. Its IUPAC name is 1-O-[6-[(Z)-4-(4-hydroxybutoxy)-4-oxobut-2-enoyl]oxy-6-oxohexanoyl] 4-O-(2-hydroxypropanoyl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[6-[(Z)-4-(4-hydroxybutoxy)-4-oxobut-2-enoyl]oxy-6-oxohexanoyl] 4-O-(2-hydroxypropanoyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 174877234 |
| Molecular Formula | C25H28O13 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 1-O-[6-[(Z)-4-(4-hydroxybutoxy)-4-oxobut-2-enoyl]oxy-6-oxohexanoyl] 4-O-(2-hydroxypropanoyl) benzene-1,4-dicarboxylate |
| SMILES | CC(O)C(=O)OC(=O)c1ccc(C(=O)OC(=O)CCCCC(=O)OC(=O)/C=C\C(=O)OCCCCO)cc1 |
| InChI | InChI=1S/C25H28O13/c1-16(27)23(32)38-25(34)18-10-8-17(9-11-18)24(33)37-21(30)7-3-2-6-20(29)36-22(31)13-12-19(28)35-15-5-4-14-26/h8-13,16,26-27H,2-7,14-15H2,1H3/b13-12- |
| InChIKey | YEGLAHPTDGLGAA-SEYXRHQNSA-N |
| XLogP | 0.94 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|