C30H44O11 — CID 171581163
1-O-(4-hydroxybutyl) 4-O-[4-[6-[4-(2-methylpropanoyloxy)butoxy]-6-oxohexanoyl]oxybutyl] benzene-1,4-dicarboxylate (PubChem CID 171581163) has the molecular formula C30H44O11 and a molecular weight of 580.67 g/mol. Its IUPAC name is 1-O-(4-hydroxybutyl) 4-O-[4-[6-[4-(2-methylpropanoyloxy)butoxy]-6-oxohexanoyl]oxybutyl] benzene-1,4-dicarboxylate.
| Compound Name | 1-O-(4-hydroxybutyl) 4-O-[4-[6-[4-(2-methylpropanoyloxy)butoxy]-6-oxohexanoyl]oxybutyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 171581163 |
| Molecular Formula | C30H44O11 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | 1-O-(4-hydroxybutyl) 4-O-[4-[6-[4-(2-methylpropanoyloxy)butoxy]-6-oxohexanoyl]oxybutyl] benzene-1,4-dicarboxylate |
| SMILES | CC(C)C(=O)OCCCCOC(=O)CCCCC(=O)OCCCCOC(=O)c1ccc(C(=O)OCCCCO)cc1 |
| InChI | InChI=1S/C30H44O11/c1-23(2)28(34)39-21-9-7-18-37-26(32)11-3-4-12-27(33)38-19-8-10-22-41-30(36)25-15-13-24(14-16-25)29(35)40-20-6-5-17-31/h13-16,23,31H,3-12,17-22H2,1-2H3 |
| InChIKey | VWJWQRQKLZJJFB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|