C17H20O7 — CID 69126349
1-O-ethyl 4-O-[5-(2-hydroxyphenoxy)-5-oxopentyl] (Z)-but-2-enedioate (PubChem CID 69126349) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[5-(2-hydroxyphenoxy)-5-oxopentyl] (Z)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[5-(2-hydroxyphenoxy)-5-oxopentyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 69126349 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-O-ethyl 4-O-[5-(2-hydroxyphenoxy)-5-oxopentyl] (Z)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C\C(=O)OCCCCC(=O)Oc1ccccc1O |
| InChI | InChI=1S/C17H20O7/c1-2-22-15(19)10-11-16(20)23-12-6-5-9-17(21)24-14-8-4-3-7-13(14)18/h3-4,7-8,10-11,18H,2,5-6,9,12H2,1H3/b11-10- |
| InChIKey | KQQIMURFUKOROA-KHPPLWFESA-N |
| XLogP | 2.13 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|